C21H26O4 — CID 14133730
(2S,3R,5S,6R)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxane (PubChem CID 14133730) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxane.
| Compound Name | (2S,3R,5S,6R)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 14133730 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2S,3R,5S,6R)-2-methoxy-6-methyl-3,5-bis(phenylmethoxy)oxane |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H26O4/c1-16-19(23-14-17-9-5-3-6-10-17)13-20(21(22-2)25-16)24-15-18-11-7-4-8-12-18/h3-12,16,19-21H,13-15H2,1-2H3/t16-,19+,20-,21+/m1/s1 |
| InChIKey | UDGKTWDCBPDWIK-RCOXNQKVSA-N |
| XLogP | 3.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |