C17H24O5 — CID 170851181
(1R)-1-[(2S,3R,5S)-3,6-dimethoxy-5-phenylmethoxyoxan-2-yl]prop-2-en-1-ol (PubChem CID 170851181) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (1R)-1-[(2S,3R,5S)-3,6-dimethoxy-5-phenylmethoxyoxan-2-yl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(2S,3R,5S)-3,6-dimethoxy-5-phenylmethoxyoxan-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 170851181 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (1R)-1-[(2S,3R,5S)-3,6-dimethoxy-5-phenylmethoxyoxan-2-yl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@@H]1OC(OC)[C@@H](OCc2ccccc2)C[C@H]1OC |
| InChI | InChI=1S/C17H24O5/c1-4-13(18)16-14(19-2)10-15(17(20-3)22-16)21-11-12-8-6-5-7-9-12/h4-9,13-18H,1,10-11H2,2-3H3/t13-,14-,15+,16+,17?/m1/s1 |
| InChIKey | UVJYXUWUVBEINV-ILUDGRTOSA-N |
| XLogP | 1.90 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|