C18H26O4 — CID 11771197
(2R,3S,5R,6S)-3-methoxy-2-(methoxymethyl)-5-phenylmethoxy-6-prop-2-enyloxane (PubChem CID 11771197) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2R,3S,5R,6S)-3-methoxy-2-(methoxymethyl)-5-phenylmethoxy-6-prop-2-enyloxane.
| Compound Name | (2R,3S,5R,6S)-3-methoxy-2-(methoxymethyl)-5-phenylmethoxy-6-prop-2-enyloxane |
|---|---|
| PubChem CID | 11771197 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2R,3S,5R,6S)-3-methoxy-2-(methoxymethyl)-5-phenylmethoxy-6-prop-2-enyloxane |
| SMILES | C=CC[C@@H]1O[C@H](COC)[C@@H](OC)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H26O4/c1-4-8-15-17(21-12-14-9-6-5-7-10-14)11-16(20-3)18(22-15)13-19-2/h4-7,9-10,15-18H,1,8,11-13H2,2-3H3/t15-,16-,17+,18+/m0/s1 |
| InChIKey | YNCVUROSYBDTIU-WNRNVDISSA-N |
| XLogP | 2.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|