C29H34O6 — CID 123779801
1-[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethanol (PubChem CID 123779801) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is 1-[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethanol.
| Compound Name | 1-[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethanol |
|---|---|
| PubChem CID | 123779801 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 1-[6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]ethanol |
| SMILES | COC1OC(C(C)O)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H34O6/c1-21(30)25-26(32-18-22-12-6-3-7-13-22)27(33-19-23-14-8-4-9-15-23)28(29(31-2)35-25)34-20-24-16-10-5-11-17-24/h3-17,21,25-30H,18-20H2,1-2H3 |
| InChIKey | YSKIJCCVGJNOAO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |