C30H35NO7 — CID 90113505
N-[hydroxy-[(2S,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]acetamide (PubChem CID 90113505) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is N-[hydroxy-[(2S,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]acetamide.
| Compound Name | N-[hydroxy-[(2S,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 90113505 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N-[hydroxy-[(2S,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]acetamide |
| SMILES | CO[C@H]1O[C@H](C(O)NC(C)=O)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H35NO7/c1-21(32)31-29(33)27-25(35-18-22-12-6-3-7-13-22)26(36-19-23-14-8-4-9-15-23)28(30(34-2)38-27)37-20-24-16-10-5-11-17-24/h3-17,25-30,33H,18-20H2,1-2H3,(H,31,32)/t25-,26+,27+,28-,29?,30+/m1/s1 |
| InChIKey | MVSXNBHUHYPGMB-HZCIEBHLSA-N |
| XLogP | 3.57 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|