C36H42O9 — CID 23244417
[2-acetyloxy-3-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]pent-4-enyl] acetate (PubChem CID 23244417) has the molecular formula C36H42O9 and a molecular weight of 618.72 g/mol. Its IUPAC name is [2-acetyloxy-3-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]pent-4-enyl] acetate.
| Compound Name | [2-acetyloxy-3-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]pent-4-enyl] acetate |
|---|---|
| PubChem CID | 23244417 |
| Molecular Formula | C36H42O9 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | [2-acetyloxy-3-[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]pent-4-enyl] acetate |
| SMILES | C=CC(C(COC(C)=O)OC(C)=O)[C@H]1O[C@H](OC)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H42O9/c1-5-30(31(44-26(3)38)24-40-25(2)37)32-33(41-21-27-15-9-6-10-16-27)34(42-22-28-17-11-7-12-18-28)35(36(39-4)45-32)43-23-29-19-13-8-14-20-29/h5-20,30-36H,1,21-24H2,2-4H3/t30?,31?,32-,33-,34+,35+,36+/m1/s1 |
| InChIKey | XFELAPUPOPPABZ-CQWSQMQPSA-N |
| XLogP | 5.41 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|