C14H19N3O3 — CID 101123036
(2S,3R,5S,6R)-5-azido-2-methoxy-6-methyl-3-phenylmethoxyoxane (PubChem CID 101123036) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (2S,3R,5S,6R)-5-azido-2-methoxy-6-methyl-3-phenylmethoxyoxane.
| Compound Name | (2S,3R,5S,6R)-5-azido-2-methoxy-6-methyl-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 101123036 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (2S,3R,5S,6R)-5-azido-2-methoxy-6-methyl-3-phenylmethoxyoxane |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H19N3O3/c1-10-12(16-17-15)8-13(14(18-2)20-10)19-9-11-6-4-3-5-7-11/h3-7,10,12-14H,8-9H2,1-2H3/t10-,12+,13-,14+/m1/s1 |
| InChIKey | OPGKGHUCTSZLKB-CABNGKKXSA-N |
| XLogP | 3.03 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|