C13H18FN4O+ — CID 102198313
(3R,4R,6R)-3-azido-6-fluoro-4-phenylmethoxyazepan-1-ium (PubChem CID 102198313) has the molecular formula C13H18FN4O+ and a molecular weight of 265.31 g/mol. Its IUPAC name is (3R,4R,6R)-3-azido-6-fluoro-4-phenylmethoxyazepan-1-ium.
| Compound Name | (3R,4R,6R)-3-azido-6-fluoro-4-phenylmethoxyazepan-1-ium |
|---|---|
| PubChem CID | 102198313 |
| Molecular Formula | C13H18FN4O+ |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (3R,4R,6R)-3-azido-6-fluoro-4-phenylmethoxyazepan-1-ium |
| SMILES | [N-]=[N+]=N[C@@H]1C[NH2+]C[C@H](F)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H17FN4O/c14-11-6-13(12(17-18-15)8-16-7-11)19-9-10-4-2-1-3-5-10/h1-5,11-13,16H,6-9H2/p+1/t11-,12-,13-/m1/s1 |
| InChIKey | RLUPNOAKOQAWHC-JHJVBQTASA-O |
| XLogP | 1.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|