C20H22ClN3O3 — CID 54341772
(2R,3S,5R,6R)-2-(azidomethyl)-6-chloro-3,5-bis(phenylmethoxy)oxane (PubChem CID 54341772) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is (2R,3S,5R,6R)-2-(azidomethyl)-6-chloro-3,5-bis(phenylmethoxy)oxane.
| Compound Name | (2R,3S,5R,6R)-2-(azidomethyl)-6-chloro-3,5-bis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 54341772 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (2R,3S,5R,6R)-2-(azidomethyl)-6-chloro-3,5-bis(phenylmethoxy)oxane |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@H](Cl)[C@H](OCc2ccccc2)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H22ClN3O3/c21-20-18(26-14-16-9-5-2-6-10-16)11-17(19(27-20)12-23-24-22)25-13-15-7-3-1-4-8-15/h1-10,17-20H,11-14H2/t17-,18+,19+,20-/m0/s1 |
| InChIKey | TZLTUADKKZWJDS-NMLBUPMWSA-N |
| XLogP | 4.82 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|