C13H16ClN3O2 — CID 101080842
(3R,5R)-5-(2-azidoethyl)-2-chloro-3-phenylmethoxyoxolane (PubChem CID 101080842) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is (3R,5R)-5-(2-azidoethyl)-2-chloro-3-phenylmethoxyoxolane.
| Compound Name | (3R,5R)-5-(2-azidoethyl)-2-chloro-3-phenylmethoxyoxolane |
|---|---|
| PubChem CID | 101080842 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (3R,5R)-5-(2-azidoethyl)-2-chloro-3-phenylmethoxyoxolane |
| SMILES | [N-]=[N+]=NCC[C@@H]1C[C@@H](OCc2ccccc2)C(Cl)O1 |
| InChI | InChI=1S/C13H16ClN3O2/c14-13-12(8-11(19-13)6-7-16-17-15)18-9-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2/t11-,12-,13?/m1/s1 |
| InChIKey | IKXGALFOAGDSLU-ZNRZSNADSA-N |
| XLogP | 3.63 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|