C32H35N3O5 — CID 101198132
(2R,3R,4S,5S,6R,8R)-8-(azidomethyl)-6-ethenyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[4.4]nonane (PubChem CID 101198132) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R,8R)-8-(azidomethyl)-6-ethenyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[4.4]nonane.
| Compound Name | (2R,3R,4S,5S,6R,8R)-8-(azidomethyl)-6-ethenyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 101198132 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | (2R,3R,4S,5S,6R,8R)-8-(azidomethyl)-6-ethenyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[4.4]nonane |
| SMILES | C=C[C@H]1O[C@@H](CN=[N+]=[N-])C[C@]12O[C@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C32H35N3O5/c1-2-29-32(18-27(39-29)19-34-35-33)31(38-22-26-16-10-5-11-17-26)30(37-21-25-14-8-4-9-15-25)28(40-32)23-36-20-24-12-6-3-7-13-24/h2-17,27-31H,1,18-23H2/t27-,28-,29-,30-,31+,32+/m1/s1 |
| InChIKey | VWCAHYYDOINYOZ-GJLCVQKQSA-N |
| XLogP | 6.17 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|