C34H35N3O5 — CID 22088767
2-(azidomethyl)-3,4,5,6-tetrakis(phenylmethoxy)oxane (PubChem CID 22088767) has the molecular formula C34H35N3O5 and a molecular weight of 565.67 g/mol. Its IUPAC name is 2-(azidomethyl)-3,4,5,6-tetrakis(phenylmethoxy)oxane.
| Compound Name | 2-(azidomethyl)-3,4,5,6-tetrakis(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 22088767 |
| Molecular Formula | C34H35N3O5 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-(azidomethyl)-3,4,5,6-tetrakis(phenylmethoxy)oxane |
| SMILES | [N-]=[N+]=NCC1OC(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C34H35N3O5/c35-37-36-21-30-31(38-22-26-13-5-1-6-14-26)32(39-23-27-15-7-2-8-16-27)33(40-24-28-17-9-3-10-18-28)34(42-30)41-25-29-19-11-4-12-20-29/h1-20,30-34H,21-25H2 |
| InChIKey | VOTQGQDHMHGYRX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|