C37H41N9O9 — CID 11181802
[(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,3R,4S,5R,6R)-6-(azidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexyl] acetate (PubChem CID 11181802) has the molecular formula C37H41N9O9 and a molecular weight of 755.79 g/mol. Its IUPAC name is [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,3R,4S,5R,6R)-6-(azidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexyl] acetate.
| Compound Name | [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,3R,4S,5R,6R)-6-(azidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexyl] acetate |
|---|---|
| PubChem CID | 11181802 |
| Molecular Formula | C37H41N9O9 |
| Molecular Weight | 755.79 g/mol |
| Exact Mass | 755.30 |
| IUPAC Name | [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,3R,4S,5R,6R)-6-(azidomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])C[C@H](N=[N+]=[N-])[C@H]1O[C@H]1O[C@H](CN=[N+]=[N-])[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H41N9O9/c1-23(47)52-31-28(42-45-39)18-29(43-46-40)32(35(31)53-24(2)48)55-37-36(51-22-27-16-10-5-11-17-27)34(50-21-26-14-8-4-9-15-26)33(30(54-37)19-41-44-38)49-20-25-12-6-3-7-13-25/h3-17,28-37H,18-22H2,1-2H3/t28-,29+,30-,31+,32-,33-,34+,35-,36-,37-/m1/s1 |
| InChIKey | LUHAQGCUBANWEJ-JCBWZERISA-N |
| XLogP | 6.79 |
| TPSA | 245.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.79 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|