C23H27FN12O6 — CID 167267034
[(1S,2S)-2-acetyloxy-4,6-diazido-3-[(2R,4R,5R,6R)-3-azido-6-(azidomethyl)-4-fluoro-5-phenylmethoxyoxan-2-yl]cyclohexyl] acetate (PubChem CID 167267034) has the molecular formula C23H27FN12O6 and a molecular weight of 586.55 g/mol. Its IUPAC name is [(1S,2S)-2-acetyloxy-4,6-diazido-3-[(2R,4R,5R,6R)-3-azido-6-(azidomethyl)-4-fluoro-5-phenylmethoxyoxan-2-yl]cyclohexyl] acetate.
| Compound Name | [(1S,2S)-2-acetyloxy-4,6-diazido-3-[(2R,4R,5R,6R)-3-azido-6-(azidomethyl)-4-fluoro-5-phenylmethoxyoxan-2-yl]cyclohexyl] acetate |
|---|---|
| PubChem CID | 167267034 |
| Molecular Formula | C23H27FN12O6 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | [(1S,2S)-2-acetyloxy-4,6-diazido-3-[(2R,4R,5R,6R)-3-azido-6-(azidomethyl)-4-fluoro-5-phenylmethoxyoxan-2-yl]cyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1C(N=[N+]=[N-])CC(N=[N+]=[N-])C(C2O[C@H](CN=[N+]=[N-])[C@@H](OCc3ccccc3)[C@H](F)C2N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H27FN12O6/c1-11(37)40-20-15(31-35-27)8-14(30-34-26)17(23(20)41-12(2)38)22-19(32-36-28)18(24)21(16(42-22)9-29-33-25)39-10-13-6-4-3-5-7-13/h3-7,14-23H,8-10H2,1-2H3/t14?,15?,16-,17?,18-,19?,20+,21-,22?,23+/m1/s1 |
| InChIKey | NMLCFDWVUZBYSS-KYLYGPTPSA-N |
| XLogP | 4.91 |
| TPSA | 266.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|