C20H26FN9O5 — CID 167683740
4,6-diazido-3-[6-(azidomethyl)-4-fluoro-5-methyl-3-phenylmethoxyoxan-2-yl]oxycyclohexane-1,2-diol (PubChem CID 167683740) has the molecular formula C20H26FN9O5 and a molecular weight of 491.48 g/mol. Its IUPAC name is 4,6-diazido-3-[6-(azidomethyl)-4-fluoro-5-methyl-3-phenylmethoxyoxan-2-yl]oxycyclohexane-1,2-diol.
| Compound Name | 4,6-diazido-3-[6-(azidomethyl)-4-fluoro-5-methyl-3-phenylmethoxyoxan-2-yl]oxycyclohexane-1,2-diol |
|---|---|
| PubChem CID | 167683740 |
| Molecular Formula | C20H26FN9O5 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 4,6-diazido-3-[6-(azidomethyl)-4-fluoro-5-methyl-3-phenylmethoxyoxan-2-yl]oxycyclohexane-1,2-diol |
| SMILES | CC1C(CN=[N+]=[N-])OC(OC2C(N=[N+]=[N-])CC(N=[N+]=[N-])C(O)C2O)C(OCc2ccccc2)C1F |
| InChI | InChI=1S/C20H26FN9O5/c1-10-14(8-25-28-22)34-20(19(15(10)21)33-9-11-5-3-2-4-6-11)35-18-13(27-30-24)7-12(26-29-23)16(31)17(18)32/h2-6,10,12-20,31-32H,7-9H2,1H3 |
| InChIKey | XQHSPAFYZYKHIR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 214.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|