C30H34N12O8 — CID 134822669
[(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-3-deuterio-4,5-bis(phenylmethoxy)oxan-2-yl]oxycyclohexyl] acetate (PubChem CID 134822669) has the molecular formula C30H34N12O8 and a molecular weight of 691.68 g/mol. Its IUPAC name is [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-3-deuterio-4,5-bis(phenylmethoxy)oxan-2-yl]oxycyclohexyl] acetate.
| Compound Name | [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-3-deuterio-4,5-bis(phenylmethoxy)oxan-2-yl]oxycyclohexyl] acetate |
|---|---|
| PubChem CID | 134822669 |
| Molecular Formula | C30H34N12O8 |
| Molecular Weight | 691.68 g/mol |
| Exact Mass | 691.27 |
| IUPAC Name | [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-3-deuterio-4,5-bis(phenylmethoxy)oxan-2-yl]oxycyclohexyl] acetate |
| SMILES | [2H][C@]1(N=[N+]=[N-])[C@@H](O[C@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])C[C@@H]2N=[N+]=[N-])O[C@H](CN=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C30H34N12O8/c1-17(43)47-25-21(36-40-32)13-22(37-41-33)26(29(25)48-18(2)44)50-30-24(38-42-34)28(46-16-20-11-7-4-8-12-20)27(23(49-30)14-35-39-31)45-15-19-9-5-3-6-10-19/h3-12,21-30H,13-16H2,1-2H3/t21-,22+,23-,24-,25+,26-,27-,28-,29-,30-/m1/s1/i24D |
| InChIKey | WXXPZCMLRRABHG-SNEUIBHBSA-N |
| XLogP | 5.88 |
| TPSA | 284.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.68 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|