C33H39N3O13 — CID 101072321
[(2R,3R,4S,5R,6R)-4-acetyloxy-6-[(2R,3R,4R,5R)-4,5-diacetyloxy-2-(azidomethyl)oxolan-3-yl]oxy-5-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate (PubChem CID 101072321) has the molecular formula C33H39N3O13 and a molecular weight of 685.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4-acetyloxy-6-[(2R,3R,4R,5R)-4,5-diacetyloxy-2-(azidomethyl)oxolan-3-yl]oxy-5-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-4-acetyloxy-6-[(2R,3R,4R,5R)-4,5-diacetyloxy-2-(azidomethyl)oxolan-3-yl]oxy-5-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 101072321 |
| Molecular Formula | C33H39N3O13 |
| Molecular Weight | 685.68 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4-acetyloxy-6-[(2R,3R,4R,5R)-4,5-diacetyloxy-2-(azidomethyl)oxolan-3-yl]oxy-5-phenylmethoxy-2-(phenylmethoxymethyl)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@H](CN=[N+]=[N-])[C@@H](O[C@H]2O[C@H](COCc3ccccc3)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H39N3O13/c1-19(37)43-28-26(18-41-16-23-11-7-5-8-12-23)48-32(30(29(28)44-20(2)38)42-17-24-13-9-6-10-14-24)49-27-25(15-35-36-34)47-33(46-22(4)40)31(27)45-21(3)39/h5-14,25-33H,15-18H2,1-4H3/t25-,26-,27-,28-,29+,30-,31-,32-,33+/m1/s1 |
| InChIKey | JFCJWPBBEIVVLU-KRJIUAOWSA-N |
| XLogP | 3.29 |
| TPSA | 200.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.68 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|