C17H20N6O5 — CID 102410576
[(1R,3S,4R,6S)-3-acetyloxy-4,6-diazido-2-phenylmethoxycyclohexyl] acetate (PubChem CID 102410576) has the molecular formula C17H20N6O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is [(1R,3S,4R,6S)-3-acetyloxy-4,6-diazido-2-phenylmethoxycyclohexyl] acetate.
| Compound Name | [(1R,3S,4R,6S)-3-acetyloxy-4,6-diazido-2-phenylmethoxycyclohexyl] acetate |
|---|---|
| PubChem CID | 102410576 |
| Molecular Formula | C17H20N6O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(1R,3S,4R,6S)-3-acetyloxy-4,6-diazido-2-phenylmethoxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1C(OCc2ccccc2)[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C17H20N6O5/c1-10(24)27-15-13(20-22-18)8-14(21-23-19)16(28-11(2)25)17(15)26-9-12-6-4-3-5-7-12/h3-7,13-17H,8-9H2,1-2H3/t13-,14+,15+,16-,17? |
| InChIKey | SPGJIKHCKXCJNW-YUCXICBCSA-N |
| XLogP | 3.20 |
| TPSA | 159.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|