C33H39N7O10 — CID 150310039
[(2R,3R,6S)-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-2-[(1R,2S,3S,4R,6S)-2,3-diacetyloxy-4,6-diazidocyclohexyl]oxyoxan-3-yl] acetate (PubChem CID 150310039) has the molecular formula C33H39N7O10 and a molecular weight of 693.71 g/mol. Its IUPAC name is [(2R,3R,6S)-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-2-[(1R,2S,3S,4R,6S)-2,3-diacetyloxy-4,6-diazidocyclohexyl]oxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,6S)-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-2-[(1R,2S,3S,4R,6S)-2,3-diacetyloxy-4,6-diazidocyclohexyl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 150310039 |
| Molecular Formula | C33H39N7O10 |
| Molecular Weight | 693.71 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | [(2R,3R,6S)-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]-2-[(1R,2S,3S,4R,6S)-2,3-diacetyloxy-4,6-diazidocyclohexyl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])C[C@H](N=[N+]=[N-])[C@H]1O[C@H]1O[C@H](CN(Cc2ccccc2)C(=O)OCc2ccccc2)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H39N7O10/c1-20(41)46-28-15-14-25(18-40(17-23-10-6-4-7-11-23)33(44)45-19-24-12-8-5-9-13-24)49-32(28)50-30-27(37-39-35)16-26(36-38-34)29(47-21(2)42)31(30)48-22(3)43/h4-13,25-32H,14-19H2,1-3H3/t25-,26+,27-,28+,29-,30+,31+,32+/m0/s1 |
| InChIKey | GLKMSCAIFPVCSJ-HOFNWDQZSA-N |
| XLogP | 5.27 |
| TPSA | 224.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|