C27H32N10O6 — CID 168793344
benzyl N-[[5-azido-6-(4,6-diazido-2,3-dihydroxycyclohexyl)oxyoxan-2-yl]methyl]-N-benzylcarbamate (PubChem CID 168793344) has the molecular formula C27H32N10O6 and a molecular weight of 592.62 g/mol. Its IUPAC name is benzyl N-[[5-azido-6-(4,6-diazido-2,3-dihydroxycyclohexyl)oxyoxan-2-yl]methyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[[5-azido-6-(4,6-diazido-2,3-dihydroxycyclohexyl)oxyoxan-2-yl]methyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 168793344 |
| Molecular Formula | C27H32N10O6 |
| Molecular Weight | 592.62 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | benzyl N-[[5-azido-6-(4,6-diazido-2,3-dihydroxycyclohexyl)oxyoxan-2-yl]methyl]-N-benzylcarbamate |
| SMILES | [N-]=[N+]=NC1CCC(CN(Cc2ccccc2)C(=O)OCc2ccccc2)OC1OC1C(N=[N+]=[N-])CC(N=[N+]=[N-])C(O)C1O |
| InChI | InChI=1S/C27H32N10O6/c28-34-31-20-12-11-19(42-26(20)43-25-22(33-36-30)13-21(32-35-29)23(38)24(25)39)15-37(14-17-7-3-1-4-8-17)27(40)41-16-18-9-5-2-6-10-18/h1-10,19-26,38-39H,11-16H2 |
| InChIKey | ACCLSAAZSVMTIC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 234.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|