C32H38N10O8 — CID 164843841
[(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,6S)-3-azido-6-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]ethyl]oxan-2-yl]oxycyclohexyl] acetate (PubChem CID 164843841) has the molecular formula C32H38N10O8 and a molecular weight of 690.72 g/mol. Its IUPAC name is [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,6S)-3-azido-6-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]ethyl]oxan-2-yl]oxycyclohexyl] acetate.
| Compound Name | [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,6S)-3-azido-6-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]ethyl]oxan-2-yl]oxycyclohexyl] acetate |
|---|---|
| PubChem CID | 164843841 |
| Molecular Formula | C32H38N10O8 |
| Molecular Weight | 690.72 g/mol |
| Exact Mass | 690.29 |
| IUPAC Name | [(1S,2S,3R,4S,6R)-2-acetyloxy-4,6-diazido-3-[(2R,6S)-3-azido-6-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]ethyl]oxan-2-yl]oxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])C[C@H](N=[N+]=[N-])[C@H]1O[C@H]1O[C@H]([C@H](C)N(Cc2ccccc2)C(=O)OCc2ccccc2)CCC1N=[N+]=[N-] |
| InChI | InChI=1S/C32H38N10O8/c1-19(42(17-22-10-6-4-7-11-22)32(45)46-18-23-12-8-5-9-13-23)27-15-14-24(36-39-33)31(49-27)50-29-26(38-41-35)16-25(37-40-34)28(47-20(2)43)30(29)48-21(3)44/h4-13,19,24-31H,14-18H2,1-3H3/t19-,24?,25+,26-,27-,28-,29+,30+,31+/m0/s1 |
| InChIKey | RJOYIYVEGDTWMP-AQLLVXBHSA-N |
| XLogP | 6.41 |
| TPSA | 246.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.72 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|