C29H36N10O5 — CID 167546569
benzyl N-[(1R)-1-[(2S,5R,6R)-5-azido-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2-hydroxy-3-methylcyclohexyl]oxyoxan-2-yl]ethyl]-N-benzylcarbamate (PubChem CID 167546569) has the molecular formula C29H36N10O5 and a molecular weight of 604.67 g/mol. Its IUPAC name is benzyl N-[(1R)-1-[(2S,5R,6R)-5-azido-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2-hydroxy-3-methylcyclohexyl]oxyoxan-2-yl]ethyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[(1R)-1-[(2S,5R,6R)-5-azido-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2-hydroxy-3-methylcyclohexyl]oxyoxan-2-yl]ethyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 167546569 |
| Molecular Formula | C29H36N10O5 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | benzyl N-[(1R)-1-[(2S,5R,6R)-5-azido-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2-hydroxy-3-methylcyclohexyl]oxyoxan-2-yl]ethyl]-N-benzylcarbamate |
| SMILES | C[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H]([C@@H](C)N(Cc3ccccc3)C(=O)OCc3ccccc3)CC[C@H]2N=[N+]=[N-])[C@@H](N=[N+]=[N-])C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C29H36N10O5/c1-18-23(34-37-31)15-24(35-38-32)27(26(18)40)44-28-22(33-36-30)13-14-25(43-28)19(2)39(16-20-9-5-3-6-10-20)29(41)42-17-21-11-7-4-8-12-21/h3-12,18-19,22-28,40H,13-17H2,1-2H3/t18-,19+,22+,23+,24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | MTIOAKICHIJOSZ-XNRQHTCDSA-N |
| XLogP | 6.54 |
| TPSA | 214.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|