C21H29N7O7 — CID 164843833
benzyl N-[(1R)-1-[(2S,5S,6R)-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxy-5-hydroxyoxan-2-yl]ethyl]carbamate (PubChem CID 164843833) has the molecular formula C21H29N7O7 and a molecular weight of 491.51 g/mol. Its IUPAC name is benzyl N-[(1R)-1-[(2S,5S,6R)-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxy-5-hydroxyoxan-2-yl]ethyl]carbamate.
| Compound Name | benzyl N-[(1R)-1-[(2S,5S,6R)-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxy-5-hydroxyoxan-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 164843833 |
| Molecular Formula | C21H29N7O7 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | benzyl N-[(1R)-1-[(2S,5S,6R)-6-[(1R,2R,3S,4R,6S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxy-5-hydroxyoxan-2-yl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OCc1ccccc1)[C@@H]1CC[C@H](O)[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N=[N+]=[N-])C[C@@H]2N=[N+]=[N-])O1 |
| InChI | InChI=1S/C21H29N7O7/c1-11(24-21(32)33-10-12-5-3-2-4-6-12)16-8-7-15(29)20(34-16)35-19-14(26-28-23)9-13(25-27-22)17(30)18(19)31/h2-6,11,13-20,29-31H,7-10H2,1H3,(H,24,32)/t11-,13-,14+,15+,16+,17+,18-,19-,20-/m1/s1 |
| InChIKey | OJTBSGIUVMQSCI-UVAVNTRNSA-N |
| XLogP | 2.04 |
| TPSA | 215.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|