C33H40N10O8 — CID 166506811
[2-acetyloxy-4,6-diazido-3-[3-azido-6-[1-[benzyl(phenylmethoxycarbonyl)amino]propyl]oxan-2-yl]oxycyclohexyl] acetate (PubChem CID 166506811) has the molecular formula C33H40N10O8 and a molecular weight of 704.75 g/mol. Its IUPAC name is [2-acetyloxy-4,6-diazido-3-[3-azido-6-[1-[benzyl(phenylmethoxycarbonyl)amino]propyl]oxan-2-yl]oxycyclohexyl] acetate.
| Compound Name | [2-acetyloxy-4,6-diazido-3-[3-azido-6-[1-[benzyl(phenylmethoxycarbonyl)amino]propyl]oxan-2-yl]oxycyclohexyl] acetate |
|---|---|
| PubChem CID | 166506811 |
| Molecular Formula | C33H40N10O8 |
| Molecular Weight | 704.75 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | [2-acetyloxy-4,6-diazido-3-[3-azido-6-[1-[benzyl(phenylmethoxycarbonyl)amino]propyl]oxan-2-yl]oxycyclohexyl] acetate |
| SMILES | CCC(C1CCC(N=[N+]=[N-])C(OC2C(N=[N+]=[N-])CC(N=[N+]=[N-])C(OC(C)=O)C2OC(C)=O)O1)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H40N10O8/c1-4-27(43(18-22-11-7-5-8-12-22)33(46)47-19-23-13-9-6-10-14-23)28-16-15-24(37-40-34)32(50-28)51-30-26(39-42-36)17-25(38-41-35)29(48-20(2)44)31(30)49-21(3)45/h5-14,24-32H,4,15-19H2,1-3H3 |
| InChIKey | BWDLWZADQIRPMP-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 246.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|