C24H30N4O3 — CID 167630590
benzyl N-[1-(5-azido-6-methyloxan-2-yl)propyl]-N-benzylcarbamate (PubChem CID 167630590) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is benzyl N-[1-(5-azido-6-methyloxan-2-yl)propyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[1-(5-azido-6-methyloxan-2-yl)propyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 167630590 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | benzyl N-[1-(5-azido-6-methyloxan-2-yl)propyl]-N-benzylcarbamate |
| SMILES | CCC(C1CCC(N=[N+]=[N-])C(C)O1)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H30N4O3/c1-3-22(23-15-14-21(26-27-25)18(2)31-23)28(16-19-10-6-4-7-11-19)24(29)30-17-20-12-8-5-9-13-20/h4-13,18,21-23H,3,14-17H2,1-2H3 |
| InChIKey | ODGSJKKUXNSIQA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|