C28H33FN10O5 — CID 167266438
benzyl N-[(1S)-1-[(2S,6R)-5-azido-6-[(2S,3S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate (PubChem CID 167266438) has the molecular formula C28H33FN10O5 and a molecular weight of 608.64 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[(2S,6R)-5-azido-6-[(2S,3S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[(1S)-1-[(2S,6R)-5-azido-6-[(2S,3S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 167266438 |
| Molecular Formula | C28H33FN10O5 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | benzyl N-[(1S)-1-[(2S,6R)-5-azido-6-[(2S,3S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxan-2-yl]-2-fluoroethyl]-N-benzylcarbamate |
| SMILES | [N-]=[N+]=NC1CC[C@@H]([C@@H](CF)N(Cc2ccccc2)C(=O)OCc2ccccc2)OC1C1C(N=[N+]=[N-])CC(N=[N+]=[N-])[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H33FN10O5/c29-14-22(39(15-17-7-3-1-4-8-17)28(42)43-16-18-9-5-2-6-10-18)23-12-11-19(33-36-30)27(44-23)24-20(34-37-31)13-21(35-38-32)25(40)26(24)41/h1-10,19-27,40-41H,11-16H2/t19?,20?,21?,22-,23+,24?,25+,26+,27?/m1/s1 |
| InChIKey | ZZRMMJFGWFDEEB-FONBAAIOSA-N |
| XLogP | 5.49 |
| TPSA | 225.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|