C35H40N10O6 — CID 167266551
benzyl N-[(1R)-1-[(2S,6R)-5-azido-6-[(2S,3S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxan-2-yl]-2-phenylmethoxyethyl]-N-benzylcarbamate (PubChem CID 167266551) has the molecular formula C35H40N10O6 and a molecular weight of 696.77 g/mol. Its IUPAC name is benzyl N-[(1R)-1-[(2S,6R)-5-azido-6-[(2S,3S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxan-2-yl]-2-phenylmethoxyethyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[(1R)-1-[(2S,6R)-5-azido-6-[(2S,3S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxan-2-yl]-2-phenylmethoxyethyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 167266551 |
| Molecular Formula | C35H40N10O6 |
| Molecular Weight | 696.77 g/mol |
| Exact Mass | 696.31 |
| IUPAC Name | benzyl N-[(1R)-1-[(2S,6R)-5-azido-6-[(2S,3S)-4,6-diazido-2,3-dihydroxycyclohexyl]oxan-2-yl]-2-phenylmethoxyethyl]-N-benzylcarbamate |
| SMILES | [N-]=[N+]=NC1CC[C@@H]([C@@H](COCc2ccccc2)N(Cc2ccccc2)C(=O)OCc2ccccc2)OC1C1C(N=[N+]=[N-])CC(N=[N+]=[N-])[C@H](O)[C@H]1O |
| InChI | InChI=1S/C35H40N10O6/c36-42-39-26-16-17-30(51-34(26)31-27(40-43-37)18-28(41-44-38)32(46)33(31)47)29(22-49-20-24-12-6-2-7-13-24)45(19-23-10-4-1-5-11-23)35(48)50-21-25-14-8-3-9-15-25/h1-15,26-34,46-47H,16-22H2/t26?,27?,28?,29-,30+,31?,32+,33+,34?/m1/s1 |
| InChIKey | LQODZCTYLUYMQD-ZLPIEKOWSA-N |
| XLogP | 6.74 |
| TPSA | 234.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.77 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|