C28H35N7O6 — CID 139575414
benzyl N-[[(2S)-5-azido-6-[(1R,2S,3S,5S,6R)-4-azido-2,3,5-trihydroxy-6-methylcyclohexyl]oxan-2-yl]methyl]-N-benzylcarbamate (PubChem CID 139575414) has the molecular formula C28H35N7O6 and a molecular weight of 565.63 g/mol. Its IUPAC name is benzyl N-[[(2S)-5-azido-6-[(1R,2S,3S,5S,6R)-4-azido-2,3,5-trihydroxy-6-methylcyclohexyl]oxan-2-yl]methyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[[(2S)-5-azido-6-[(1R,2S,3S,5S,6R)-4-azido-2,3,5-trihydroxy-6-methylcyclohexyl]oxan-2-yl]methyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 139575414 |
| Molecular Formula | C28H35N7O6 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | benzyl N-[[(2S)-5-azido-6-[(1R,2S,3S,5S,6R)-4-azido-2,3,5-trihydroxy-6-methylcyclohexyl]oxan-2-yl]methyl]-N-benzylcarbamate |
| SMILES | C[C@@H]1[C@@H](C2O[C@H](CN(Cc3ccccc3)C(=O)OCc3ccccc3)CCC2N=[N+]=[N-])[C@H](O)[C@@H](O)C(N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C28H35N7O6/c1-17-22(25(37)26(38)23(24(17)36)32-34-30)27-21(31-33-29)13-12-20(41-27)15-35(14-18-8-4-2-5-9-18)28(39)40-16-19-10-6-3-7-11-19/h2-11,17,20-27,36-38H,12-16H2,1H3/t17-,20+,21?,22-,23?,24+,25+,26+,27?/m1/s1 |
| InChIKey | MKCUKVNOWIZTRQ-GLDVXHGUSA-N |
| XLogP | 4.08 |
| TPSA | 196.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|