C31H36N10O9 — CID 175781432
2-[(1S,2R,3S,4S,5R,6S)-3-acetyloxy-2,6-diazido-5-[(2R,3R,6S)-3-azido-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]oxan-2-yl]oxy-4-hydroxycyclohexyl]acetic acid (PubChem CID 175781432) has the molecular formula C31H36N10O9 and a molecular weight of 692.69 g/mol. Its IUPAC name is 2-[(1S,2R,3S,4S,5R,6S)-3-acetyloxy-2,6-diazido-5-[(2R,3R,6S)-3-azido-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]oxan-2-yl]oxy-4-hydroxycyclohexyl]acetic acid.
| Compound Name | 2-[(1S,2R,3S,4S,5R,6S)-3-acetyloxy-2,6-diazido-5-[(2R,3R,6S)-3-azido-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]oxan-2-yl]oxy-4-hydroxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 175781432 |
| Molecular Formula | C31H36N10O9 |
| Molecular Weight | 692.69 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | 2-[(1S,2R,3S,4S,5R,6S)-3-acetyloxy-2,6-diazido-5-[(2R,3R,6S)-3-azido-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]oxan-2-yl]oxy-4-hydroxycyclohexyl]acetic acid |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CN(Cc3ccccc3)C(=O)OCc3ccccc3)CC[C@H]2N=[N+]=[N-])[C@@H](N=[N+]=[N-])[C@H](CC(=O)O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C31H36N10O9/c1-18(42)48-28-25(36-39-33)22(14-24(43)44)26(37-40-34)29(27(28)45)50-30-23(35-38-32)13-12-21(49-30)16-41(15-19-8-4-2-5-9-19)31(46)47-17-20-10-6-3-7-11-20/h2-11,21-23,25-30,45H,12-17H2,1H3,(H,43,44)/t21-,22+,23+,25+,26-,27+,28-,29+,30+/m0/s1 |
| InChIKey | VGBQJARYBFRNTA-XQHCVMBTSA-N |
| XLogP | 5.15 |
| TPSA | 278.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|