C31H37N7O9 — CID 166506872
[2-(3-acetyloxy-4,6-diazido-2-hydroxycyclohexyl)oxy-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]oxan-3-yl] acetate (PubChem CID 166506872) has the molecular formula C31H37N7O9 and a molecular weight of 651.68 g/mol. Its IUPAC name is [2-(3-acetyloxy-4,6-diazido-2-hydroxycyclohexyl)oxy-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]oxan-3-yl] acetate.
| Compound Name | [2-(3-acetyloxy-4,6-diazido-2-hydroxycyclohexyl)oxy-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 166506872 |
| Molecular Formula | C31H37N7O9 |
| Molecular Weight | 651.68 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | [2-(3-acetyloxy-4,6-diazido-2-hydroxycyclohexyl)oxy-6-[[benzyl(phenylmethoxycarbonyl)amino]methyl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1CCC(CN(Cc2ccccc2)C(=O)OCc2ccccc2)OC1OC1C(N=[N+]=[N-])CC(N=[N+]=[N-])C(OC(C)=O)C1O |
| InChI | InChI=1S/C31H37N7O9/c1-19(39)44-26-14-13-23(17-38(16-21-9-5-3-6-10-21)31(42)43-18-22-11-7-4-8-12-22)46-30(26)47-29-25(35-37-33)15-24(34-36-32)28(27(29)41)45-20(2)40/h3-12,23-30,41H,13-18H2,1-2H3 |
| InChIKey | LHFPEUXISBPJAC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 218.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|