C27H35N7O10 — CID 167266783
[(2R,3R,6S)-2-[(1R,2S,3S)-2,3-diacetyloxy-4,6-diazidocyclohexyl]oxy-6-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]oxan-3-yl] acetate (PubChem CID 167266783) has the molecular formula C27H35N7O10 and a molecular weight of 617.62 g/mol. Its IUPAC name is [(2R,3R,6S)-2-[(1R,2S,3S)-2,3-diacetyloxy-4,6-diazidocyclohexyl]oxy-6-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,6S)-2-[(1R,2S,3S)-2,3-diacetyloxy-4,6-diazidocyclohexyl]oxy-6-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 167266783 |
| Molecular Formula | C27H35N7O10 |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | [(2R,3R,6S)-2-[(1R,2S,3S)-2,3-diacetyloxy-4,6-diazidocyclohexyl]oxy-6-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O[C@H]2O[C@H]([C@@H](C)NC(=O)OCc3ccccc3)CC[C@H]2OC(C)=O)C(N=[N+]=[N-])CC(N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H35N7O10/c1-14(30-27(38)39-13-18-8-6-5-7-9-18)21-10-11-22(40-15(2)35)26(43-21)44-24-20(32-34-29)12-19(31-33-28)23(41-16(3)36)25(24)42-17(4)37/h5-9,14,19-26H,10-13H2,1-4H3,(H,30,38)/t14-,19?,20?,21+,22-,23+,24-,25-,26-/m1/s1 |
| InChIKey | FHPXODQBNOYUJC-NUDNPENLSA-N |
| XLogP | 3.75 |
| TPSA | 233.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|