C30H37N7O6 — CID 139575591
[(1S,2S,3R,4S)-2-acetyloxy-6-azido-3-[(2R)-3-azido-6-[(R)-(benzylamino)-phenylmethyl]oxan-2-yl]oxy-4-methylcyclohexyl] acetate (PubChem CID 139575591) has the molecular formula C30H37N7O6 and a molecular weight of 591.67 g/mol. Its IUPAC name is [(1S,2S,3R,4S)-2-acetyloxy-6-azido-3-[(2R)-3-azido-6-[(R)-(benzylamino)-phenylmethyl]oxan-2-yl]oxy-4-methylcyclohexyl] acetate.
| Compound Name | [(1S,2S,3R,4S)-2-acetyloxy-6-azido-3-[(2R)-3-azido-6-[(R)-(benzylamino)-phenylmethyl]oxan-2-yl]oxy-4-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 139575591 |
| Molecular Formula | C30H37N7O6 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | [(1S,2S,3R,4S)-2-acetyloxy-6-azido-3-[(2R)-3-azido-6-[(R)-(benzylamino)-phenylmethyl]oxan-2-yl]oxy-4-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O[C@H]2OC([C@H](NCc3ccccc3)c3ccccc3)CCC2N=[N+]=[N-])[C@@H](C)CC(N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H37N7O6/c1-18-16-24(35-37-32)28(40-19(2)38)29(41-20(3)39)27(18)43-30-23(34-36-31)14-15-25(42-30)26(22-12-8-5-9-13-22)33-17-21-10-6-4-7-11-21/h4-13,18,23-30,33H,14-17H2,1-3H3/t18-,23?,24?,25?,26+,27+,28-,29-,30+/m0/s1 |
| InChIKey | PIMUWFAYVNETCL-ANYOMYFPSA-N |
| XLogP | 5.67 |
| TPSA | 180.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|