C18H25NO5 — CID 167610114
[(6S)-3-methyl-6-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]oxan-2-yl] acetate (PubChem CID 167610114) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(6S)-3-methyl-6-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]oxan-2-yl] acetate.
| Compound Name | [(6S)-3-methyl-6-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]oxan-2-yl] acetate |
|---|---|
| PubChem CID | 167610114 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [(6S)-3-methyl-6-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]oxan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@H]([C@@H](C)NC(=O)OCc2ccccc2)CCC1C |
| InChI | InChI=1S/C18H25NO5/c1-12-9-10-16(24-17(12)23-14(3)20)13(2)19-18(21)22-11-15-7-5-4-6-8-15/h4-8,12-13,16-17H,9-11H2,1-3H3,(H,19,21)/t12?,13-,16+,17?/m1/s1 |
| InChIKey | AKBOZCSFKMYTGU-FNIIMMMJSA-N |
| XLogP | 3.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |