C32H40N10O6 — CID 166506753
[(1S,2S,3R,4S,6R)-4,6-diazido-3-[(1S,2R,5R)-2-azido-5-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]propyl]cyclohexyl]oxy-2-hydroxycyclohexyl] acetate (PubChem CID 166506753) has the molecular formula C32H40N10O6 and a molecular weight of 660.74 g/mol. Its IUPAC name is [(1S,2S,3R,4S,6R)-4,6-diazido-3-[(1S,2R,5R)-2-azido-5-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]propyl]cyclohexyl]oxy-2-hydroxycyclohexyl] acetate.
| Compound Name | [(1S,2S,3R,4S,6R)-4,6-diazido-3-[(1S,2R,5R)-2-azido-5-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]propyl]cyclohexyl]oxy-2-hydroxycyclohexyl] acetate |
|---|---|
| PubChem CID | 166506753 |
| Molecular Formula | C32H40N10O6 |
| Molecular Weight | 660.74 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | [(1S,2S,3R,4S,6R)-4,6-diazido-3-[(1S,2R,5R)-2-azido-5-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]propyl]cyclohexyl]oxy-2-hydroxycyclohexyl] acetate |
| SMILES | CC[C@@H]([C@@H]1CC[C@@H](N=[N+]=[N-])[C@@H](O[C@H]2[C@H](O)[C@@H](OC(C)=O)[C@H](N=[N+]=[N-])C[C@@H]2N=[N+]=[N-])C1)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H40N10O6/c1-3-27(42(18-21-10-6-4-7-11-21)32(45)46-19-22-12-8-5-9-13-22)23-14-15-24(36-39-33)28(16-23)48-31-26(38-41-35)17-25(37-40-34)30(29(31)44)47-20(2)43/h4-13,23-31,44H,3,14-19H2,1-2H3/t23-,24-,25-,26+,27+,28+,29-,30+,31-/m1/s1 |
| InChIKey | BXYQJDXLIRJYBD-ORYKIQNYSA-N |
| XLogP | 6.89 |
| TPSA | 231.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.74 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|