C31H40N8O6 — CID 167267430
[(1S,2S)-3-[(2R,3R,6S)-3-amino-6-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]propyl]oxan-2-yl]-4,6-diazido-2-hydroxycyclohexyl] acetate (PubChem CID 167267430) has the molecular formula C31H40N8O6 and a molecular weight of 620.71 g/mol. Its IUPAC name is [(1S,2S)-3-[(2R,3R,6S)-3-amino-6-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]propyl]oxan-2-yl]-4,6-diazido-2-hydroxycyclohexyl] acetate.
| Compound Name | [(1S,2S)-3-[(2R,3R,6S)-3-amino-6-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]propyl]oxan-2-yl]-4,6-diazido-2-hydroxycyclohexyl] acetate |
|---|---|
| PubChem CID | 167267430 |
| Molecular Formula | C31H40N8O6 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | [(1S,2S)-3-[(2R,3R,6S)-3-amino-6-[(1S)-1-[benzyl(phenylmethoxycarbonyl)amino]propyl]oxan-2-yl]-4,6-diazido-2-hydroxycyclohexyl] acetate |
| SMILES | CC[C@@H]([C@@H]1CC[C@@H](N)C(C2C(N=[N+]=[N-])CC(N=[N+]=[N-])[C@H](OC(C)=O)[C@H]2O)O1)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H40N8O6/c1-3-25(39(17-20-10-6-4-7-11-20)31(42)43-18-21-12-8-5-9-13-21)26-15-14-22(32)29(45-26)27-23(35-37-33)16-24(36-38-34)30(28(27)41)44-19(2)40/h4-13,22-30,41H,3,14-18,32H2,1-2H3/t22-,23?,24?,25+,26+,27?,28+,29?,30+/m1/s1 |
| InChIKey | KCXANCNLWIGULR-WJJSDWCISA-N |
| XLogP | 5.15 |
| TPSA | 208.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|