C33H34N4O6 — CID 140927659
benzyl N-[[(2S,4R,5R)-3-azido-4-hydroxy-6-methyl-5-(naphthalen-2-ylmethoxy)oxan-2-yl]oxymethyl]-N-benzylcarbamate (PubChem CID 140927659) has the molecular formula C33H34N4O6 and a molecular weight of 582.66 g/mol. Its IUPAC name is benzyl N-[[(2S,4R,5R)-3-azido-4-hydroxy-6-methyl-5-(naphthalen-2-ylmethoxy)oxan-2-yl]oxymethyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[[(2S,4R,5R)-3-azido-4-hydroxy-6-methyl-5-(naphthalen-2-ylmethoxy)oxan-2-yl]oxymethyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 140927659 |
| Molecular Formula | C33H34N4O6 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | benzyl N-[[(2S,4R,5R)-3-azido-4-hydroxy-6-methyl-5-(naphthalen-2-ylmethoxy)oxan-2-yl]oxymethyl]-N-benzylcarbamate |
| SMILES | CC1O[C@@H](OCN(Cc2ccccc2)C(=O)OCc2ccccc2)C(N=[N+]=[N-])[C@@H](O)[C@H]1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H34N4O6/c1-23-31(40-21-26-16-17-27-14-8-9-15-28(27)18-26)30(38)29(35-36-34)32(43-23)42-22-37(19-24-10-4-2-5-11-24)33(39)41-20-25-12-6-3-7-13-25/h2-18,23,29-32,38H,19-22H2,1H3/t23?,29?,30-,31+,32-/m1/s1 |
| InChIKey | NXUBUIDDNBXQMR-ZUHQJXKMSA-N |
| XLogP | 6.32 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|