C34H40N4O8 — CID 121355222
[(3R,4R,6R)-5-azido-6-[6-[benzyl(phenylmethoxycarbonyl)amino]hexoxy]-3,4-dihydroxyoxan-2-yl]methyl benzoate (PubChem CID 121355222) has the molecular formula C34H40N4O8 and a molecular weight of 632.71 g/mol. Its IUPAC name is [(3R,4R,6R)-5-azido-6-[6-[benzyl(phenylmethoxycarbonyl)amino]hexoxy]-3,4-dihydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3R,4R,6R)-5-azido-6-[6-[benzyl(phenylmethoxycarbonyl)amino]hexoxy]-3,4-dihydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 121355222 |
| Molecular Formula | C34H40N4O8 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | [(3R,4R,6R)-5-azido-6-[6-[benzyl(phenylmethoxycarbonyl)amino]hexoxy]-3,4-dihydroxyoxan-2-yl]methyl benzoate |
| SMILES | [N-]=[N+]=NC1[C@H](OCCCCCCN(Cc2ccccc2)C(=O)OCc2ccccc2)OC(COC(=O)c2ccccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C34H40N4O8/c35-37-36-29-31(40)30(39)28(24-44-32(41)27-18-10-5-11-19-27)46-33(29)43-21-13-2-1-12-20-38(22-25-14-6-3-7-15-25)34(42)45-23-26-16-8-4-9-17-26/h3-11,14-19,28-31,33,39-40H,1-2,12-13,20-24H2/t28?,29?,30-,31+,33+/m0/s1 |
| InChIKey | ZNRNFOMSJPMCPX-BADOJAJWSA-N |
| XLogP | 5.39 |
| TPSA | 163.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|