C18H25N3O6 — CID 89167969
[(3S,6S)-5-azido-4-butoxy-3-hydroxy-6-methoxyoxan-2-yl]methyl benzoate (PubChem CID 89167969) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is [(3S,6S)-5-azido-4-butoxy-3-hydroxy-6-methoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(3S,6S)-5-azido-4-butoxy-3-hydroxy-6-methoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 89167969 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | [(3S,6S)-5-azido-4-butoxy-3-hydroxy-6-methoxyoxan-2-yl]methyl benzoate |
| SMILES | CCCCOC1C(N=[N+]=[N-])[C@@H](OC)OC(COC(=O)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C18H25N3O6/c1-3-4-10-25-16-14(20-21-19)18(24-2)27-13(15(16)22)11-26-17(23)12-8-6-5-7-9-12/h5-9,13-16,18,22H,3-4,10-11H2,1-2H3/t13?,14?,15-,16?,18+/m1/s1 |
| InChIKey | QBKHDDKRIPBDOR-WIXNPGLQSA-N |
| XLogP | 2.44 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|