C13H23N3O5 — CID 118910937
[(3S,5R,6S)-5-azido-4-butoxy-3-hydroxy-6-methyloxan-2-yl]methyl acetate (PubChem CID 118910937) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is [(3S,5R,6S)-5-azido-4-butoxy-3-hydroxy-6-methyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,5R,6S)-5-azido-4-butoxy-3-hydroxy-6-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118910937 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [(3S,5R,6S)-5-azido-4-butoxy-3-hydroxy-6-methyloxan-2-yl]methyl acetate |
| SMILES | CCCCOC1[C@H](O)C(COC(C)=O)O[C@@H](C)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C13H23N3O5/c1-4-5-6-19-13-11(15-16-14)8(2)21-10(12(13)18)7-20-9(3)17/h8,10-13,18H,4-7H2,1-3H3/t8-,10?,11+,12+,13?/m0/s1 |
| InChIKey | QEMFYIGZLKRMBR-TWFLLJKNSA-N |
| XLogP | 1.56 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|