C18H25N3O5S — CID 118883365
[(3S,4S,6R)-4-azido-5-butoxy-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl acetate (PubChem CID 118883365) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is [(3S,4S,6R)-4-azido-5-butoxy-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6R)-4-azido-5-butoxy-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118883365 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(3S,4S,6R)-4-azido-5-butoxy-3-hydroxy-6-phenylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CCCCOC1[C@@H](Sc2ccccc2)OC(COC(C)=O)[C@@H](O)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C18H25N3O5S/c1-3-4-10-24-17-15(20-21-19)16(23)14(11-25-12(2)22)26-18(17)27-13-8-6-5-7-9-13/h5-9,14-18,23H,3-4,10-11H2,1-2H3/t14?,15-,16+,17?,18+/m0/s1 |
| InChIKey | GRHLWUJRRDHAEW-USFGWYQBSA-N |
| XLogP | 3.29 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|