C24H40O5S — CID 70920985
[(3R,6S)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]methanol (PubChem CID 70920985) has the molecular formula C24H40O5S and a molecular weight of 440.65 g/mol. Its IUPAC name is [(3R,6S)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]methanol.
| Compound Name | [(3R,6S)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 70920985 |
| Molecular Formula | C24H40O5S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [(3R,6S)-3,4,5-tributoxy-6-phenylsulfanyloxan-2-yl]methanol |
| SMILES | CCCCOC1C(OCCCC)[C@H](Sc2ccccc2)OC(CO)[C@H]1OCCCC |
| InChI | InChI=1S/C24H40O5S/c1-4-7-15-26-21-20(18-25)29-24(30-19-13-11-10-12-14-19)23(28-17-9-6-3)22(21)27-16-8-5-2/h10-14,20-25H,4-9,15-18H2,1-3H3/t20?,21-,22?,23?,24+/m1/s1 |
| InChIKey | XQKDIRSSURDYKZ-GZKSJMNASA-N |
| XLogP | 5.05 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|