C16H24O4S — CID 70962762
(2S,3R,4R,5R,6S)-5-butoxy-2-methyl-6-phenylsulfanyloxane-3,4-diol (PubChem CID 70962762) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-5-butoxy-2-methyl-6-phenylsulfanyloxane-3,4-diol.
| Compound Name | (2S,3R,4R,5R,6S)-5-butoxy-2-methyl-6-phenylsulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 70962762 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2S,3R,4R,5R,6S)-5-butoxy-2-methyl-6-phenylsulfanyloxane-3,4-diol |
| SMILES | CCCCO[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C16H24O4S/c1-3-4-10-19-15-14(18)13(17)11(2)20-16(15)21-12-8-6-5-7-9-12/h5-9,11,13-18H,3-4,10H2,1-2H3/t11-,13-,14+,15+,16-/m0/s1 |
| InChIKey | PGWVCAVPSSKGBZ-GZFHQYITSA-N |
| XLogP | 2.43 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|