C12H16O3S — CID 97302359
(2R,3S,4R,6R)-6-methyl-2-phenylsulfanyloxane-3,4-diol (PubChem CID 97302359) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is (2R,3S,4R,6R)-6-methyl-2-phenylsulfanyloxane-3,4-diol.
| Compound Name | (2R,3S,4R,6R)-6-methyl-2-phenylsulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 97302359 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (2R,3S,4R,6R)-6-methyl-2-phenylsulfanyloxane-3,4-diol |
| SMILES | C[C@@H]1C[C@@H](O)[C@H](O)[C@@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C12H16O3S/c1-8-7-10(13)11(14)12(15-8)16-9-5-3-2-4-6-9/h2-6,8,10-14H,7H2,1H3/t8-,10-,11+,12-/m1/s1 |
| InChIKey | CPLHPMJQEAMSCN-KXGXSXBTSA-N |
| XLogP | 1.64 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |