C14H20O2S — CID 58708353
2,4,5-trimethyl-6-phenylsulfanyloxan-3-ol (PubChem CID 58708353) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 2,4,5-trimethyl-6-phenylsulfanyloxan-3-ol.
| Compound Name | 2,4,5-trimethyl-6-phenylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 58708353 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2,4,5-trimethyl-6-phenylsulfanyloxan-3-ol |
| SMILES | CC1OC(Sc2ccccc2)C(C)C(C)C1O |
| InChI | InChI=1S/C14H20O2S/c1-9-10(2)14(16-11(3)13(9)15)17-12-7-5-4-6-8-12/h4-11,13-15H,1-3H3 |
| InChIKey | IXEIZTQYKFTXPQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |