C21H24O4S — CID 58784418
(4-methoxy-2,5-dimethyl-6-phenylsulfanyloxan-3-yl) benzoate (PubChem CID 58784418) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is (4-methoxy-2,5-dimethyl-6-phenylsulfanyloxan-3-yl) benzoate.
| Compound Name | (4-methoxy-2,5-dimethyl-6-phenylsulfanyloxan-3-yl) benzoate |
|---|---|
| PubChem CID | 58784418 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (4-methoxy-2,5-dimethyl-6-phenylsulfanyloxan-3-yl) benzoate |
| SMILES | COC1C(C)C(Sc2ccccc2)OC(C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24O4S/c1-14-18(23-3)19(25-20(22)16-10-6-4-7-11-16)15(2)24-21(14)26-17-12-8-5-9-13-17/h4-15,18-19,21H,1-3H3 |
| InChIKey | VIRAZDBHTMZBAO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |