C34H28O9S — CID 102010345
methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 102010345) has the molecular formula C34H28O9S and a molecular weight of 612.66 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 102010345 |
| Molecular Formula | C34H28O9S |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H28O9S/c1-39-33(38)28-26(40-30(35)22-14-6-2-7-15-22)27(41-31(36)23-16-8-3-9-17-23)29(42-32(37)24-18-10-4-11-19-24)34(43-28)44-25-20-12-5-13-21-25/h2-21,26-29,34H,1H3/t26-,27-,28-,29+,34-/m0/s1 |
| InChIKey | SADKFDXQVAAOCC-PVICZJAMSA-N |
| XLogP | 5.35 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|