C22H22O9 — CID 10455350
methyl (2S,3S,4R,5R,6R)-3,4-dibenzoyloxy-5-hydroxy-6-methoxyoxane-2-carboxylate (PubChem CID 10455350) has the molecular formula C22H22O9 and a molecular weight of 430.41 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6R)-3,4-dibenzoyloxy-5-hydroxy-6-methoxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6R)-3,4-dibenzoyloxy-5-hydroxy-6-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 10455350 |
| Molecular Formula | C22H22O9 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | methyl (2S,3S,4R,5R,6R)-3,4-dibenzoyloxy-5-hydroxy-6-methoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](OC)[C@H](O)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H22O9/c1-27-21(26)18-17(30-20(25)14-11-7-4-8-12-14)16(15(23)22(28-2)31-18)29-19(24)13-9-5-3-6-10-13/h3-12,15-18,22-23H,1-2H3/t15-,16-,17+,18+,22-/m1/s1 |
| InChIKey | FHYQUWGAHNRBKT-XMJOBFJKSA-N |
| XLogP | 1.34 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|