C21H19N3O8 — CID 53254560
methyl (2S,3S,4S,5R,6R)-6-azido-4,5-dibenzoyloxy-3-hydroxyoxane-2-carboxylate (PubChem CID 53254560) has the molecular formula C21H19N3O8 and a molecular weight of 441.40 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-6-azido-4,5-dibenzoyloxy-3-hydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-6-azido-4,5-dibenzoyloxy-3-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 53254560 |
| Molecular Formula | C21H19N3O8 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-6-azido-4,5-dibenzoyloxy-3-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](N=[N+]=[N-])[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C21H19N3O8/c1-29-21(28)16-14(25)15(31-19(26)12-8-4-2-5-9-12)17(18(30-16)23-24-22)32-20(27)13-10-6-3-7-11-13/h2-11,14-18,25H,1H3/t14-,15-,16-,17+,18+/m0/s1 |
| InChIKey | TVYWSWWEZPXHOU-NNPSNHGLSA-N |
| XLogP | 2.01 |
| TPSA | 157.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|