C42H43N3O12 — CID 90949111
methyl (3S,4S,6R)-3-[(2R,4R,5R)-3-azido-6-ethyl-5-hydroxy-4-phenylmethoxyoxan-2-yl]oxy-4,5-dibenzoyloxy-6-phenylmethoxyoxane-2-carboxylate (PubChem CID 90949111) has the molecular formula C42H43N3O12 and a molecular weight of 781.82 g/mol. Its IUPAC name is methyl (3S,4S,6R)-3-[(2R,4R,5R)-3-azido-6-ethyl-5-hydroxy-4-phenylmethoxyoxan-2-yl]oxy-4,5-dibenzoyloxy-6-phenylmethoxyoxane-2-carboxylate.
| Compound Name | methyl (3S,4S,6R)-3-[(2R,4R,5R)-3-azido-6-ethyl-5-hydroxy-4-phenylmethoxyoxan-2-yl]oxy-4,5-dibenzoyloxy-6-phenylmethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 90949111 |
| Molecular Formula | C42H43N3O12 |
| Molecular Weight | 781.82 g/mol |
| Exact Mass | 781.28 |
| IUPAC Name | methyl (3S,4S,6R)-3-[(2R,4R,5R)-3-azido-6-ethyl-5-hydroxy-4-phenylmethoxyoxan-2-yl]oxy-4,5-dibenzoyloxy-6-phenylmethoxyoxane-2-carboxylate |
| SMILES | CCC1O[C@H](O[C@@H]2C(C(=O)OC)O[C@@H](OCc3ccccc3)C(OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)C(N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C42H43N3O12/c1-3-30-32(46)33(51-24-26-16-8-4-9-17-26)31(44-45-43)41(53-30)56-34-35(54-38(47)28-20-12-6-13-21-28)37(55-39(48)29-22-14-7-15-23-29)42(57-36(34)40(49)50-2)52-25-27-18-10-5-11-19-27/h4-23,30-37,41-42,46H,3,24-25H2,1-2H3/t30?,31?,32-,33-,34+,35+,36?,37?,41-,42-/m1/s1 |
| InChIKey | QJOFUWBVMHHZPT-GODCJPFISA-N |
| XLogP | 5.70 |
| TPSA | 194.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.82 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|