C13H15N3O6 — CID 130197821
[(2R,3S,5R)-3-azido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] benzoate (PubChem CID 130197821) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is [(2R,3S,5R)-3-azido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] benzoate.
| Compound Name | [(2R,3S,5R)-3-azido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 130197821 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(2R,3S,5R)-3-azido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@H]1C(OC(=O)c2ccccc2)[C@@H](O)C(CO)O[C@H]1O |
| InChI | InChI=1S/C13H15N3O6/c14-16-15-9-11(10(18)8(6-17)21-13(9)20)22-12(19)7-4-2-1-3-5-7/h1-5,8-11,13,17-18,20H,6H2/t8?,9-,10-,11?,13+/m0/s1 |
| InChIKey | KYFZWLDRJSKYLT-XKPMGNOJSA-N |
| XLogP | -0.04 |
| TPSA | 144.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|